C11H14F3NO3 — CID 114247148
2-hexan-2-yl-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid (PubChem CID 114247148) has the molecular formula C11H14F3NO3 and a molecular weight of 265.23 g/mol. Its IUPAC name is 2-hexan-2-yl-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid.
| Compound Name | 2-hexan-2-yl-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 114247148 |
| Molecular Formula | C11H14F3NO3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-hexan-2-yl-4-(trifluoromethyl)-1,3-oxazole-5-carboxylic acid |
| SMILES | CCCCC(C)c1nc(C(F)(F)F)c(C(=O)O)o1 |
| InChI | InChI=1S/C11H14F3NO3/c1-3-4-5-6(2)9-15-8(11(12,13)14)7(18-9)10(16)17/h6H,3-5H2,1-2H3,(H,16,17) |
| InChIKey | YJLFZNHNKFJOSX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |