2-[(2S)-pentan-2-yl]-1,3-oxazole-4-carboxylic acid

C9H13NO3 — CID 161037098

IUPAC2-[(2S)-pentan-2-yl]-1,3-oxazole-4-carboxylic acid
SMILESCCC[C@H](C)c1nc(C(=O)O)co1
InChIInChI=1S/C9H13NO3/c1-3-4-6(2)8-10-7(5-13-8)9(11)12/h5-6H,3-4H2,1-2H3,(H,11,12)/t6-/m0/s1
InChIKeyOKPCZUHMFAISDU-LURJTMIESA-N
MW183.21 g/mol
LogP2.28
Rot. Bonds4

About 2-[(2S)-pentan-2-yl]-1,3-oxazole-4-carboxylic acid

2-[(2S)-pentan-2-yl]-1,3-oxazole-4-carboxylic acid (PubChem CID 161037098) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-[(2S)-pentan-2-yl]-1,3-oxazole-4-carboxylic acid.

Molecular Properties

Compound Name2-[(2S)-pentan-2-yl]-1,3-oxazole-4-carboxylic acid
PubChem CID161037098
Molecular FormulaC9H13NO3
Molecular Weight183.21 g/mol
Exact Mass183.09
IUPAC Name2-[(2S)-pentan-2-yl]-1,3-oxazole-4-carboxylic acid
SMILESCCC[C@H](C)c1nc(C(=O)O)co1
InChIInChI=1S/C9H13NO3/c1-3-4-6(2)8-10-7(5-13-8)9(11)12/h5-6H,3-4H2,1-2H3,(H,11,12)/t6-/m0/s1
InChIKeyOKPCZUHMFAISDU-LURJTMIESA-N
XLogP2.28
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.21
LogP ≤ 52.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[(2S)-pentan-2-yl]-1,3-oxazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2S)-pentan-2-yl]-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 2-[(2S)-pentan-2-yl]-1,3-oxazole-4-carboxylic acid (CID 161037098) is 2-[(2S)-pentan-2-yl]-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 2-[(2S)-pentan-2-yl]-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 2-[(2S)-pentan-2-yl]-1,3-oxazole-4-carboxylic acid is CCC[C@H](C)c1nc(C(=O)O)co1.
What is the InChIKey of 2-[(2S)-pentan-2-yl]-1,3-oxazole-4-carboxylic acid?
The InChIKey is OKPCZUHMFAISDU-LURJTMIESA-N. The full InChI is InChI=1S/C9H13NO3/c1-3-4-6(2)8-10-7(5-13-8)9(11)12/h5-6H,3-4H2,1-2H3,(H,11,12)/t6-/m0/s1.
What are the key properties of 2-[(2S)-pentan-2-yl]-1,3-oxazole-4-carboxylic acid?
2-[(2S)-pentan-2-yl]-1,3-oxazole-4-carboxylic acid has a molecular weight of 183.21 g/mol, XLogP of 2.28, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-pentan-2-yl]-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 161037098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).