C9H15N3O3 — CID 101420648
2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid (PubChem CID 101420648) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 101420648 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid |
| SMILES | NCCCC[C@@H](N)c1nc(C(=O)O)co1 |
| InChI | InChI=1S/C9H15N3O3/c10-4-2-1-3-6(11)8-12-7(5-15-8)9(13)14/h5-6H,1-4,10-11H2,(H,13,14)/t6-/m1/s1 |
| InChIKey | VWDOWLMPDBAOOC-ZCFIWIBFSA-N |
| XLogP | 0.50 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|