2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid

C9H15N3O3 — CID 101420648

IUPAC2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid
SMILESNCCCC[C@@H](N)c1nc(C(=O)O)co1
InChIInChI=1S/C9H15N3O3/c10-4-2-1-3-6(11)8-12-7(5-15-8)9(13)14/h5-6H,1-4,10-11H2,(H,13,14)/t6-/m1/s1
InChIKeyVWDOWLMPDBAOOC-ZCFIWIBFSA-N
MW213.24 g/mol
LogP0.50
Rot. Bonds6

About 2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid

2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid (PubChem CID 101420648) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid.

Molecular Properties

Compound Name2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid
PubChem CID101420648
Molecular FormulaC9H15N3O3
Molecular Weight213.24 g/mol
Exact Mass213.11
IUPAC Name2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid
SMILESNCCCC[C@@H](N)c1nc(C(=O)O)co1
InChIInChI=1S/C9H15N3O3/c10-4-2-1-3-6(11)8-12-7(5-15-8)9(13)14/h5-6H,1-4,10-11H2,(H,13,14)/t6-/m1/s1
InChIKeyVWDOWLMPDBAOOC-ZCFIWIBFSA-N
XLogP0.50
TPSA115.37 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.24
LogP ≤ 50.50
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid (CID 101420648) is 2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid is NCCCC[C@@H](N)c1nc(C(=O)O)co1.
What is the InChIKey of 2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid?
The InChIKey is VWDOWLMPDBAOOC-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H15N3O3/c10-4-2-1-3-6(11)8-12-7(5-15-8)9(13)14/h5-6H,1-4,10-11H2,(H,13,14)/t6-/m1/s1.
What are the key properties of 2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid?
2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid has a molecular weight of 213.24 g/mol, XLogP of 0.50, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R)-1,5-diaminopentyl]-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 101420648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).