C10H15NO3 — CID 162015662
2-[(2S)-hexan-2-yl]-1,3-oxazole-4-carboxylic acid (PubChem CID 162015662) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-[(2S)-hexan-2-yl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-[(2S)-hexan-2-yl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 162015662 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-[(2S)-hexan-2-yl]-1,3-oxazole-4-carboxylic acid |
| SMILES | CCCC[C@H](C)c1nc(C(=O)O)co1 |
| InChI | InChI=1S/C10H15NO3/c1-3-4-5-7(2)9-11-8(6-14-9)10(12)13/h6-7H,3-5H2,1-2H3,(H,12,13)/t7-/m0/s1 |
| InChIKey | XBBJBNLMPSACOD-ZETCQYMHSA-N |
| XLogP | 2.67 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |