About ethyl 4-hydroxy-2,2-dioxo-3H-2,1-benzothiazole-1-carboxylate
ethyl 4-hydroxy-2,2-dioxo-3H-2,1-benzothiazole-1-carboxylate (PubChem CID 11425382) has the molecular formula C10H11NO5S
and a molecular weight of 257.27 g/mol. Its IUPAC name is ethyl 4-hydroxy-2,2-dioxo-3H-2,1-benzothiazole-1-carboxylate.
Analyze ethyl 4-hydroxy-2,2-dioxo-3H-2,1-benzothiazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-hydroxy-2,2-dioxo-3H-2,1-benzothiazole-1-carboxylate?
The IUPAC name of ethyl 4-hydroxy-2,2-dioxo-3H-2,1-benzothiazole-1-carboxylate (CID 11425382) is ethyl 4-hydroxy-2,2-dioxo-3H-2,1-benzothiazole-1-carboxylate.
What is the SMILES notation for ethyl 4-hydroxy-2,2-dioxo-3H-2,1-benzothiazole-1-carboxylate?
The canonical SMILES for ethyl 4-hydroxy-2,2-dioxo-3H-2,1-benzothiazole-1-carboxylate is CCOC(=O)N1c2cccc(O)c2CS1(=O)=O.
What is the InChIKey of ethyl 4-hydroxy-2,2-dioxo-3H-2,1-benzothiazole-1-carboxylate?
The InChIKey is MGKLQIULVNFWBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO5S/c1-2-16-10(13)11-8-4-3-5-9(12)7(8)6-17(11,14)15/h3-5,12H,2,6H2,1H3.
What are the key properties of ethyl 4-hydroxy-2,2-dioxo-3H-2,1-benzothiazole-1-carboxylate?
ethyl 4-hydroxy-2,2-dioxo-3H-2,1-benzothiazole-1-carboxylate has a molecular weight of 257.27 g/mol, XLogP of 1.20, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-hydroxy-2,2-dioxo-3H-2,1-benzothiazole-1-carboxylate is sourced from PubChem (CID 11425382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).