C13H15F3IN — CID 114259853
N-[(3,3-difluorocyclohexyl)methyl]-3-fluoro-2-iodoaniline (PubChem CID 114259853) has the molecular formula C13H15F3IN and a molecular weight of 369.17 g/mol. Its IUPAC name is N-[(3,3-difluorocyclohexyl)methyl]-3-fluoro-2-iodoaniline.
| Compound Name | N-[(3,3-difluorocyclohexyl)methyl]-3-fluoro-2-iodoaniline |
|---|---|
| PubChem CID | 114259853 |
| Molecular Formula | C13H15F3IN |
| Molecular Weight | 369.17 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | N-[(3,3-difluorocyclohexyl)methyl]-3-fluoro-2-iodoaniline |
| SMILES | Fc1cccc(NCC2CCCC(F)(F)C2)c1I |
| InChI | InChI=1S/C13H15F3IN/c14-10-4-1-5-11(12(10)17)18-8-9-3-2-6-13(15,16)7-9/h1,4-5,9,18H,2-3,6-8H2 |
| InChIKey | OFOWQLXCUFAYPY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.17 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|