C12H10BrIN2OS — CID 114261938
5-[(3-bromo-4-iodoanilino)methyl]thiophene-3-carboxamide (PubChem CID 114261938) has the molecular formula C12H10BrIN2OS and a molecular weight of 437.10 g/mol. Its IUPAC name is 5-[(3-bromo-4-iodoanilino)methyl]thiophene-3-carboxamide.
| Compound Name | 5-[(3-bromo-4-iodoanilino)methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 114261938 |
| Molecular Formula | C12H10BrIN2OS |
| Molecular Weight | 437.10 g/mol |
| Exact Mass | 435.87 |
| IUPAC Name | 5-[(3-bromo-4-iodoanilino)methyl]thiophene-3-carboxamide |
| SMILES | NC(=O)c1csc(CNc2ccc(I)c(Br)c2)c1 |
| InChI | InChI=1S/C12H10BrIN2OS/c13-10-4-8(1-2-11(10)14)16-5-9-3-7(6-18-9)12(15)17/h1-4,6,16H,5H2,(H2,15,17) |
| InChIKey | VDMFTZSWWHAXAM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.10 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|