C13H18BrIN2 — CID 114262418
1-(3-bromo-4-iodophenyl)-3-ethyl-3-methylpiperazine (PubChem CID 114262418) has the molecular formula C13H18BrIN2 and a molecular weight of 409.11 g/mol. Its IUPAC name is 1-(3-bromo-4-iodophenyl)-3-ethyl-3-methylpiperazine.
| Compound Name | 1-(3-bromo-4-iodophenyl)-3-ethyl-3-methylpiperazine |
|---|---|
| PubChem CID | 114262418 |
| Molecular Formula | C13H18BrIN2 |
| Molecular Weight | 409.11 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | 1-(3-bromo-4-iodophenyl)-3-ethyl-3-methylpiperazine |
| SMILES | CCC1(C)CN(c2ccc(I)c(Br)c2)CCN1 |
| InChI | InChI=1S/C13H18BrIN2/c1-3-13(2)9-17(7-6-16-13)10-4-5-12(15)11(14)8-10/h4-5,8,16H,3,6-7,9H2,1-2H3 |
| InChIKey | QWLOWZKIGYZMQN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.11 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|