C13H11BrFNO2S — CID 114263364
4-[4-(2-bromo-4-fluorophenyl)-1,3-thiazol-2-yl]butanoic acid (PubChem CID 114263364) has the molecular formula C13H11BrFNO2S and a molecular weight of 344.21 g/mol. Its IUPAC name is 4-[4-(2-bromo-4-fluorophenyl)-1,3-thiazol-2-yl]butanoic acid.
| Compound Name | 4-[4-(2-bromo-4-fluorophenyl)-1,3-thiazol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 114263364 |
| Molecular Formula | C13H11BrFNO2S |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | 4-[4-(2-bromo-4-fluorophenyl)-1,3-thiazol-2-yl]butanoic acid |
| SMILES | O=C(O)CCCc1nc(-c2ccc(F)cc2Br)cs1 |
| InChI | InChI=1S/C13H11BrFNO2S/c14-10-6-8(15)4-5-9(10)11-7-19-12(16-11)2-1-3-13(17)18/h4-7H,1-3H2,(H,17,18) |
| InChIKey | RPNWRRLVPGFAKQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |