C14H20N2S — CID 114263379
(3S,4R)-4-phenyl-1-(thiolan-3-yl)pyrrolidin-3-amine (PubChem CID 114263379) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is (3S,4R)-4-phenyl-1-(thiolan-3-yl)pyrrolidin-3-amine.
| Compound Name | (3S,4R)-4-phenyl-1-(thiolan-3-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 114263379 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (3S,4R)-4-phenyl-1-(thiolan-3-yl)pyrrolidin-3-amine |
| SMILES | N[C@@H]1CN(C2CCSC2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H20N2S/c15-14-9-16(12-6-7-17-10-12)8-13(14)11-4-2-1-3-5-11/h1-5,12-14H,6-10,15H2/t12?,13-,14+/m0/s1 |
| InChIKey | GPGRGNRAUFGVQM-KFTPUPIBSA-N |
| XLogP | 1.92 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |