C12H15F3N2 — CID 114264599
1-N-pent-4-enyl-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 114264599) has the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. Its IUPAC name is 1-N-pent-4-enyl-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 1-N-pent-4-enyl-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 114264599 |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 1-N-pent-4-enyl-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | C=CCCCNc1ccc(N)cc1C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2/c1-2-3-4-7-17-11-6-5-9(16)8-10(11)12(13,14)15/h2,5-6,8,17H,1,3-4,7,16H2 |
| InChIKey | JPWHUKNQLPVGIN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|