C17H30O4Si — CID 11427371
1-[(1S,2R,3S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-7-oxabicyclo[4.1.0]heptan-3-yl]-3-methylbut-2-en-1-one (PubChem CID 11427371) has the molecular formula C17H30O4Si and a molecular weight of 326.51 g/mol. Its IUPAC name is 1-[(1S,2R,3S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-7-oxabicyclo[4.1.0]heptan-3-yl]-3-methylbut-2-en-1-one.
| Compound Name | 1-[(1S,2R,3S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-7-oxabicyclo[4.1.0]heptan-3-yl]-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 11427371 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 1-[(1S,2R,3S,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-7-oxabicyclo[4.1.0]heptan-3-yl]-3-methylbut-2-en-1-one |
| SMILES | CC(C)=CC(=O)[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C17H30O4Si/c1-10(2)8-12(18)11-9-13(15-16(20-15)14(11)19)21-22(6,7)17(3,4)5/h8,11,13-16,19H,9H2,1-7H3/t11-,13+,14-,15-,16+/m1/s1 |
| InChIKey | ZRJOSDZBUGTNPI-ZIRHEVKLSA-N |
| XLogP | 3.06 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|