C11H16O4 — CID 10488722
1-[(1R,2S,3R,5S,6S)-2,5-dihydroxy-7-oxabicyclo[4.1.0]heptan-3-yl]-3-methylbut-2-en-1-one (PubChem CID 10488722) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is 1-[(1R,2S,3R,5S,6S)-2,5-dihydroxy-7-oxabicyclo[4.1.0]heptan-3-yl]-3-methylbut-2-en-1-one.
| Compound Name | 1-[(1R,2S,3R,5S,6S)-2,5-dihydroxy-7-oxabicyclo[4.1.0]heptan-3-yl]-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 10488722 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 1-[(1R,2S,3R,5S,6S)-2,5-dihydroxy-7-oxabicyclo[4.1.0]heptan-3-yl]-3-methylbut-2-en-1-one |
| SMILES | CC(C)=CC(=O)[C@@H]1C[C@H](O)[C@@H]2O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C11H16O4/c1-5(2)3-7(12)6-4-8(13)10-11(15-10)9(6)14/h3,6,8-11,13-14H,4H2,1-2H3/t6-,8-,9-,10-,11+/m0/s1 |
| InChIKey | QAFLUCUTHAQHKS-BOWXYFCWSA-N |
| XLogP | 0.03 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|