C14H11IO2S — CID 114279701
(5-iodo-2,3-dihydro-1-benzofuran-7-yl)-(5-methylthiophen-2-yl)methanone (PubChem CID 114279701) has the molecular formula C14H11IO2S and a molecular weight of 370.21 g/mol. Its IUPAC name is (5-iodo-2,3-dihydro-1-benzofuran-7-yl)-(5-methylthiophen-2-yl)methanone.
| Compound Name | (5-iodo-2,3-dihydro-1-benzofuran-7-yl)-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 114279701 |
| Molecular Formula | C14H11IO2S |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 369.95 |
| IUPAC Name | (5-iodo-2,3-dihydro-1-benzofuran-7-yl)-(5-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)c2cc(I)cc3c2OCC3)s1 |
| InChI | InChI=1S/C14H11IO2S/c1-8-2-3-12(18-8)13(16)11-7-10(15)6-9-4-5-17-14(9)11/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | ZZOQIESRSKPTAU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|