About (3-benzoyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl benzoate
(3-benzoyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl benzoate (PubChem CID 11428053) has the molecular formula C19H14N2O5
and a molecular weight of 350.33 g/mol. Its IUPAC name is (3-benzoyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl benzoate.
Molecular Properties
| Compound Name | (3-benzoyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl benzoate |
| PubChem CID | 11428053 |
| Molecular Formula | C19H14N2O5 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | (3-benzoyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl benzoate |
| SMILES | O=C(OCc1c[nH]c(=O)n(C(=O)c2ccccc2)c1=O)c1ccccc1 |
| InChI | InChI=1S/C19H14N2O5/c22-16(13-7-3-1-4-8-13)21-17(23)15(11-20-19(21)25)12-26-18(24)14-9-5-2-6-10-14/h1-11H,12H2,(H,20,25) |
| InChIKey | PMFKKPHJRDFHPC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-benzoyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-benzoyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl benzoate?
The IUPAC name of (3-benzoyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl benzoate (CID 11428053) is (3-benzoyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl benzoate.
What is the SMILES notation for (3-benzoyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl benzoate?
The canonical SMILES for (3-benzoyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl benzoate is O=C(OCc1c[nH]c(=O)n(C(=O)c2ccccc2)c1=O)c1ccccc1.
What is the InChIKey of (3-benzoyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl benzoate?
The InChIKey is PMFKKPHJRDFHPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2O5/c22-16(13-7-3-1-4-8-13)21-17(23)15(11-20-19(21)25)12-26-18(24)14-9-5-2-6-10-14/h1-11H,12H2,(H,20,25).
What are the key properties of (3-benzoyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl benzoate?
(3-benzoyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl benzoate has a molecular weight of 350.33 g/mol, XLogP of 1.58, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzoyl-2,4-dioxo-1H-pyrimidin-5-yl)methyl benzoate is sourced from PubChem (CID 11428053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).