C23H23FN4O2 — CID 11429659
[4-[(4-methyl-2-pyridinyl)methyl]phenyl] 4-(5-fluoro-2-pyridinyl)piperazine-1-carboxylate (PubChem CID 11429659) has the molecular formula C23H23FN4O2 and a molecular weight of 406.46 g/mol. Its IUPAC name is [4-[(4-methyl-2-pyridinyl)methyl]phenyl] 4-(5-fluoro-2-pyridinyl)piperazine-1-carboxylate.
| Compound Name | [4-[(4-methyl-2-pyridinyl)methyl]phenyl] 4-(5-fluoro-2-pyridinyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 11429659 |
| Molecular Formula | C23H23FN4O2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | [4-[(4-methyl-2-pyridinyl)methyl]phenyl] 4-(5-fluoro-2-pyridinyl)piperazine-1-carboxylate |
| SMILES | Cc1ccnc(Cc2ccc(OC(=O)N3CCN(c4ccc(F)cn4)CC3)cc2)c1 |
| InChI | InChI=1S/C23H23FN4O2/c1-17-8-9-25-20(14-17)15-18-2-5-21(6-3-18)30-23(29)28-12-10-27(11-13-28)22-7-4-19(24)16-26-22/h2-9,14,16H,10-13,15H2,1H3 |
| InChIKey | ZGEVJTDDIAPEDA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |