C24H37NO4S — CID 11430494
ethyl 3-[(3S)-4-cyclohexyl-2-hydroxy-3-(3-phenylpropanoylamino)butyl]sulfanylpropanoate (PubChem CID 11430494) has the molecular formula C24H37NO4S and a molecular weight of 435.63 g/mol. Its IUPAC name is ethyl 3-[(3S)-4-cyclohexyl-2-hydroxy-3-(3-phenylpropanoylamino)butyl]sulfanylpropanoate.
| Compound Name | ethyl 3-[(3S)-4-cyclohexyl-2-hydroxy-3-(3-phenylpropanoylamino)butyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 11430494 |
| Molecular Formula | C24H37NO4S |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | ethyl 3-[(3S)-4-cyclohexyl-2-hydroxy-3-(3-phenylpropanoylamino)butyl]sulfanylpropanoate |
| SMILES | CCOC(=O)CCSCC(O)[C@H](CC1CCCCC1)NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C24H37NO4S/c1-2-29-24(28)15-16-30-18-22(26)21(17-20-11-7-4-8-12-20)25-23(27)14-13-19-9-5-3-6-10-19/h3,5-6,9-10,20-22,26H,2,4,7-8,11-18H2,1H3,(H,25,27)/t21-,22?/m0/s1 |
| InChIKey | FZFDJGTVVBMPAD-HMTLIYDFSA-N |
| XLogP | 4.12 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|