C12H15BrClNOS — CID 114306746
3-bromo-N-[[2-(chloromethyl)cyclopentyl]methyl]thiophene-2-carboxamide (PubChem CID 114306746) has the molecular formula C12H15BrClNOS and a molecular weight of 336.68 g/mol. Its IUPAC name is 3-bromo-N-[[2-(chloromethyl)cyclopentyl]methyl]thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-[[2-(chloromethyl)cyclopentyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 114306746 |
| Molecular Formula | C12H15BrClNOS |
| Molecular Weight | 336.68 g/mol |
| Exact Mass | 334.97 |
| IUPAC Name | 3-bromo-N-[[2-(chloromethyl)cyclopentyl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCC1CCCC1CCl)c1sccc1Br |
| InChI | InChI=1S/C12H15BrClNOS/c13-10-4-5-17-11(10)12(16)15-7-9-3-1-2-8(9)6-14/h4-5,8-9H,1-3,6-7H2,(H,15,16) |
| InChIKey | OADAIWDFXSJQGB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.68 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|