C10H13BrN2O2 — CID 114312088
N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide (PubChem CID 114312088) has the molecular formula C10H13BrN2O2 and a molecular weight of 273.13 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 114312088 |
| Molecular Formula | C10H13BrN2O2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NC1CCCCC1Br)c1ccon1 |
| InChI | InChI=1S/C10H13BrN2O2/c11-7-3-1-2-4-8(7)12-10(14)9-5-6-15-13-9/h5-8H,1-4H2,(H,12,14) |
| InChIKey | JHZQJMBZQOFEGA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|