About N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide
N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide (PubChem CID 114312088) has the molecular formula C10H13BrN2O2
and a molecular weight of 273.13 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 114312088 |
| Molecular Formula | C10H13BrN2O2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NC1CCCCC1Br)c1ccon1 |
| InChI | InChI=1S/C10H13BrN2O2/c11-7-3-1-2-4-8(7)12-10(14)9-5-6-15-13-9/h5-8H,1-4H2,(H,12,14) |
| InChIKey | JHZQJMBZQOFEGA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide?
The IUPAC name of N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide (CID 114312088) is N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide is O=C(NC1CCCCC1Br)c1ccon1.
What is the InChIKey of N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide?
The InChIKey is JHZQJMBZQOFEGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN2O2/c11-7-3-1-2-4-8(7)12-10(14)9-5-6-15-13-9/h5-8H,1-4H2,(H,12,14).
What are the key properties of N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide?
N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide has a molecular weight of 273.13 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromocyclohexyl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 114312088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).