C14H16BrNOS2 — CID 114312292
N-[(2-bromocyclohexyl)methyl]thieno[3,2-b]thiophene-5-carboxamide (PubChem CID 114312292) has the molecular formula C14H16BrNOS2 and a molecular weight of 358.33 g/mol. Its IUPAC name is N-[(2-bromocyclohexyl)methyl]thieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-[(2-bromocyclohexyl)methyl]thieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 114312292 |
| Molecular Formula | C14H16BrNOS2 |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | N-[(2-bromocyclohexyl)methyl]thieno[3,2-b]thiophene-5-carboxamide |
| SMILES | O=C(NCC1CCCCC1Br)c1cc2sccc2s1 |
| InChI | InChI=1S/C14H16BrNOS2/c15-10-4-2-1-3-9(10)8-16-14(17)13-7-12-11(19-13)5-6-18-12/h5-7,9-10H,1-4,8H2,(H,16,17) |
| InChIKey | PLMLNNJXUFUYFW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|