C20H33N3O8SSi — CID 11432087
ethyl (E)-[(2R,3R,3aR,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-3,5,6,6a-tetrahydro-2H-furo[2,3-c]pyrrol-4-ylidene]methanesulfonate (PubChem CID 11432087) has the molecular formula C20H33N3O8SSi and a molecular weight of 503.65 g/mol. Its IUPAC name is ethyl (E)-[(2R,3R,3aR,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-3,5,6,6a-tetrahydro-2H-furo[2,3-c]pyrrol-4-ylidene]methanesulfonate.
| Compound Name | ethyl (E)-[(2R,3R,3aR,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-3,5,6,6a-tetrahydro-2H-furo[2,3-c]pyrrol-4-ylidene]methanesulfonate |
|---|---|
| PubChem CID | 11432087 |
| Molecular Formula | C20H33N3O8SSi |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | ethyl (E)-[(2R,3R,3aR,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-3,5,6,6a-tetrahydro-2H-furo[2,3-c]pyrrol-4-ylidene]methanesulfonate |
| SMILES | CCOS(=O)(=O)/C=C1/NC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@]12O |
| InChI | InChI=1S/C20H33N3O8SSi/c1-8-29-32(27,28)11-13-20(26)14(9-21-13)30-17(15(20)31-33(6,7)19(3,4)5)23-10-12(2)16(24)22-18(23)25/h10-11,14-15,17,21,26H,8-9H2,1-7H3,(H,22,24,25)/b13-11+/t14-,15+,17-,20-/m1/s1 |
| InChIKey | JNXATGVPPVCHRV-MKZGEFMMSA-N |
| XLogP | 0.67 |
| TPSA | 148.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|