C18H29N3O7SSi — CID 71592646
1-[(1R,5R,8R,10R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3,3-dioxo-2,9-dioxa-3λ6-thia-6-azatricyclo[6.3.0.01,5]undecan-10-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 71592646) has the molecular formula C18H29N3O7SSi and a molecular weight of 459.60 g/mol. Its IUPAC name is 1-[(1R,5R,8R,10R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3,3-dioxo-2,9-dioxa-3λ6-thia-6-azatricyclo[6.3.0.01,5]undecan-10-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(1R,5R,8R,10R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3,3-dioxo-2,9-dioxa-3λ6-thia-6-azatricyclo[6.3.0.01,5]undecan-10-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71592646 |
| Molecular Formula | C18H29N3O7SSi |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 1-[(1R,5R,8R,10R,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3,3-dioxo-2,9-dioxa-3λ6-thia-6-azatricyclo[6.3.0.01,5]undecan-10-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@@H]3CN[C@H]4CS(=O)(=O)O[C@]43[C@H]2O[Si](C)(C)C(C)(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H29N3O7SSi/c1-10-8-21(16(23)20-14(10)22)15-13(27-30(5,6)17(2,3)4)18-11(9-29(24,25)28-18)19-7-12(18)26-15/h8,11-13,15,19H,7,9H2,1-6H3,(H,20,22,23)/t11-,12+,13-,15+,18+/m0/s1 |
| InChIKey | NYLMETNEYDWYGJ-RDHLJXKDSA-N |
| XLogP | 0.20 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|