C19H32N4O7SSi — CID 136806162
[(2R,3R,3aR,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-methylimino-3,5,6,6a-tetrahydro-2H-furo[2,3-c]pyrrol-3a-yl] methanesulfonate (PubChem CID 136806162) has the molecular formula C19H32N4O7SSi and a molecular weight of 488.64 g/mol. Its IUPAC name is [(2R,3R,3aR,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-methylimino-3,5,6,6a-tetrahydro-2H-furo[2,3-c]pyrrol-3a-yl] methanesulfonate.
| Compound Name | [(2R,3R,3aR,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-methylimino-3,5,6,6a-tetrahydro-2H-furo[2,3-c]pyrrol-3a-yl] methanesulfonate |
|---|---|
| PubChem CID | 136806162 |
| Molecular Formula | C19H32N4O7SSi |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [(2R,3R,3aR,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-4-methylimino-3,5,6,6a-tetrahydro-2H-furo[2,3-c]pyrrol-3a-yl] methanesulfonate |
| SMILES | C/N=C1\NC[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@]12OS(C)(=O)=O |
| InChI | InChI=1S/C19H32N4O7SSi/c1-11-10-23(17(25)22-14(11)24)15-13(29-32(7,8)18(2,3)4)19(30-31(6,26)27)12(28-15)9-21-16(19)20-5/h10,12-13,15H,9H2,1-8H3,(H,20,21)(H,22,24,25)/t12-,13+,15-,19-/m1/s1 |
| InChIKey | HTXYXIPGVZQFDH-FCIKYMEBSA-N |
| XLogP | 0.48 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|