C14H13BrN4O — CID 114331591
2-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]phenol (PubChem CID 114331591) has the molecular formula C14H13BrN4O and a molecular weight of 333.19 g/mol. Its IUPAC name is 2-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]phenol.
| Compound Name | 2-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]phenol |
|---|---|
| PubChem CID | 114331591 |
| Molecular Formula | C14H13BrN4O |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | 2-[[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methylamino]methyl]phenol |
| SMILES | Oc1ccccc1CNCc1cnc2cnc(Br)cn12 |
| InChI | InChI=1S/C14H13BrN4O/c15-13-9-19-11(7-18-14(19)8-17-13)6-16-5-10-3-1-2-4-12(10)20/h1-4,7-9,16,20H,5-6H2 |
| InChIKey | SJMCEKBBQBUQAR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|