C12H13BrN6 — CID 79164800
N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2-pyrazol-1-ylethanamine (PubChem CID 79164800) has the molecular formula C12H13BrN6 and a molecular weight of 321.18 g/mol. Its IUPAC name is N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2-pyrazol-1-ylethanamine.
| Compound Name | N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2-pyrazol-1-ylethanamine |
|---|---|
| PubChem CID | 79164800 |
| Molecular Formula | C12H13BrN6 |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2-pyrazol-1-ylethanamine |
| SMILES | Brc1cn2c(CNCCn3cccn3)cnc2cn1 |
| InChI | InChI=1S/C12H13BrN6/c13-11-9-19-10(7-16-12(19)8-15-11)6-14-3-5-18-4-1-2-17-18/h1-2,4,7-9,14H,3,5-6H2 |
| InChIKey | ZJQLRPYCMKCTOQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 60.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|