C13H19BrN4O2 — CID 79548562
N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,2-diethoxyethanamine (PubChem CID 79548562) has the molecular formula C13H19BrN4O2 and a molecular weight of 343.23 g/mol. Its IUPAC name is N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,2-diethoxyethanamine.
| Compound Name | N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,2-diethoxyethanamine |
|---|---|
| PubChem CID | 79548562 |
| Molecular Formula | C13H19BrN4O2 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | N-[(6-bromoimidazo[1,2-a]pyrazin-3-yl)methyl]-2,2-diethoxyethanamine |
| SMILES | CCOC(CNCc1cnc2cnc(Br)cn12)OCC |
| InChI | InChI=1S/C13H19BrN4O2/c1-3-19-13(20-4-2)8-15-5-10-6-17-12-7-16-11(14)9-18(10)12/h6-7,9,13,15H,3-5,8H2,1-2H3 |
| InChIKey | QKTSSJKTLNVCNS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|