C14H22N2 — CID 114336030
1-butan-2-yl-2,3,4,5-tetrahydro-1-benzazepin-5-amine (PubChem CID 114336030) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-butan-2-yl-2,3,4,5-tetrahydro-1-benzazepin-5-amine.
| Compound Name | 1-butan-2-yl-2,3,4,5-tetrahydro-1-benzazepin-5-amine |
|---|---|
| PubChem CID | 114336030 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1-butan-2-yl-2,3,4,5-tetrahydro-1-benzazepin-5-amine |
| SMILES | CCC(C)N1CCCC(N)c2ccccc21 |
| InChI | InChI=1S/C14H22N2/c1-3-11(2)16-10-6-8-13(15)12-7-4-5-9-14(12)16/h4-5,7,9,11,13H,3,6,8,10,15H2,1-2H3 |
| InChIKey | YLRYUALHINZPRQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |