C32H49N3Si3Zr — CID 11433734
[bis[dimethyl-[(1S)-1-phenylethyl]azanidylsilyl]methyl-dimethylsilyl]-[(1S)-1-phenylethyl]azanide;carbanide;zirconium(4+) (PubChem CID 11433734) has the molecular formula C32H49N3Si3Zr and a molecular weight of 651.25 g/mol. Its IUPAC name is [bis[dimethyl-[(1S)-1-phenylethyl]azanidylsilyl]methyl-dimethylsilyl]-[(1S)-1-phenylethyl]azanide;carbanide;zirconium(4+).
| Compound Name | [bis[dimethyl-[(1S)-1-phenylethyl]azanidylsilyl]methyl-dimethylsilyl]-[(1S)-1-phenylethyl]azanide;carbanide;zirconium(4+) |
|---|---|
| PubChem CID | 11433734 |
| Molecular Formula | C32H49N3Si3Zr |
| Molecular Weight | 651.25 g/mol |
| Exact Mass | 649.23 |
| IUPAC Name | [bis[dimethyl-[(1S)-1-phenylethyl]azanidylsilyl]methyl-dimethylsilyl]-[(1S)-1-phenylethyl]azanide;carbanide;zirconium(4+) |
| SMILES | C[C@H]([N-][Si](C)(C)C([Si](C)(C)[N-][C@@H](C)c1ccccc1)[Si](C)(C)[N-][C@@H](C)c1ccccc1)c1ccccc1.[CH3-].[Zr+4] |
| InChI | InChI=1S/C31H46N3Si3.CH3.Zr/c1-25(28-19-13-10-14-20-28)32-35(4,5)31(36(6,7)33-26(2)29-21-15-11-16-22-29)37(8,9)34-27(3)30-23-17-12-18-24-30;;/h10-27,31H,1-9H3;1H3;/q-3;-1;+4/t25-,26-,27-;;/m0../s1 |
| InChIKey | BPRSPIRTMNVEBE-DXDRFYQPSA-N |
| XLogP | 10.90 |
| TPSA | 42.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.25 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|