C13H25NO — CID 114338178
1-[1-(3-methylbut-2-enyl)piperidin-2-yl]propan-2-ol (PubChem CID 114338178) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 1-[1-(3-methylbut-2-enyl)piperidin-2-yl]propan-2-ol.
| Compound Name | 1-[1-(3-methylbut-2-enyl)piperidin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 114338178 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 1-[1-(3-methylbut-2-enyl)piperidin-2-yl]propan-2-ol |
| SMILES | CC(C)=CCN1CCCCC1CC(C)O |
| InChI | InChI=1S/C13H25NO/c1-11(2)7-9-14-8-5-4-6-13(14)10-12(3)15/h7,12-13,15H,4-6,8-10H2,1-3H3 |
| InChIKey | MGWRAGZYDAEUAD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|