C14H15N5OS — CID 114355187
3-(methoxymethyl)-6-(1,2,3,4-tetrahydroquinolin-6-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 114355187) has the molecular formula C14H15N5OS and a molecular weight of 301.38 g/mol. Its IUPAC name is 3-(methoxymethyl)-6-(1,2,3,4-tetrahydroquinolin-6-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-(methoxymethyl)-6-(1,2,3,4-tetrahydroquinolin-6-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 114355187 |
| Molecular Formula | C14H15N5OS |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 3-(methoxymethyl)-6-(1,2,3,4-tetrahydroquinolin-6-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | COCc1nnc2sc(-c3ccc4c(c3)CCCN4)nn12 |
| InChI | InChI=1S/C14H15N5OS/c1-20-8-12-16-17-14-19(12)18-13(21-14)10-4-5-11-9(7-10)3-2-6-15-11/h4-5,7,15H,2-3,6,8H2,1H3 |
| InChIKey | TVLXCTAHLYPFQN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |