C12H13BrN4 — CID 106463225
6-(5-bromo-3-methyltriazol-4-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 106463225) has the molecular formula C12H13BrN4 and a molecular weight of 293.17 g/mol. Its IUPAC name is 6-(5-bromo-3-methyltriazol-4-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-(5-bromo-3-methyltriazol-4-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106463225 |
| Molecular Formula | C12H13BrN4 |
| Molecular Weight | 293.17 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 6-(5-bromo-3-methyltriazol-4-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | Cn1nnc(Br)c1-c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C12H13BrN4/c1-17-11(12(13)15-16-17)9-4-5-10-8(7-9)3-2-6-14-10/h4-5,7,14H,2-3,6H2,1H3 |
| InChIKey | DFSZJAUEQSZYEW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.17 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |