C13H19F2NOS — CID 114370299
3-amino-2-(2,5-difluorophenyl)sulfanyl-4,4-dimethylpentan-1-ol (PubChem CID 114370299) has the molecular formula C13H19F2NOS and a molecular weight of 275.36 g/mol. Its IUPAC name is 3-amino-2-(2,5-difluorophenyl)sulfanyl-4,4-dimethylpentan-1-ol.
| Compound Name | 3-amino-2-(2,5-difluorophenyl)sulfanyl-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 114370299 |
| Molecular Formula | C13H19F2NOS |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-amino-2-(2,5-difluorophenyl)sulfanyl-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(C)C(N)C(CO)Sc1cc(F)ccc1F |
| InChI | InChI=1S/C13H19F2NOS/c1-13(2,3)12(16)11(7-17)18-10-6-8(14)4-5-9(10)15/h4-6,11-12,17H,7,16H2,1-3H3 |
| InChIKey | GOLXOKCSYHRKED-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |