C16H32OSi — CID 11437114
trimethyl-[(E)-2-[(2R,3R)-3-nonyloxiran-2-yl]ethenyl]silane (PubChem CID 11437114) has the molecular formula C16H32OSi and a molecular weight of 268.52 g/mol. Its IUPAC name is trimethyl-[(E)-2-[(2R,3R)-3-nonyloxiran-2-yl]ethenyl]silane.
| Compound Name | trimethyl-[(E)-2-[(2R,3R)-3-nonyloxiran-2-yl]ethenyl]silane |
|---|---|
| PubChem CID | 11437114 |
| Molecular Formula | C16H32OSi |
| Molecular Weight | 268.52 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | trimethyl-[(E)-2-[(2R,3R)-3-nonyloxiran-2-yl]ethenyl]silane |
| SMILES | CCCCCCCCC[C@H]1O[C@@H]1/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C16H32OSi/c1-5-6-7-8-9-10-11-12-15-16(17-15)13-14-18(2,3)4/h13-16H,5-12H2,1-4H3/b14-13+/t15-,16-/m1/s1 |
| InChIKey | AKHZMKZNRYAWTB-GHAJFHELSA-N |
| XLogP | 5.33 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|