C15H12Br2N2 — CID 114373909
2-(2,5-dibromophenyl)-4,6-dimethyl-1H-benzimidazole (PubChem CID 114373909) has the molecular formula C15H12Br2N2 and a molecular weight of 380.08 g/mol. Its IUPAC name is 2-(2,5-dibromophenyl)-4,6-dimethyl-1H-benzimidazole.
| Compound Name | 2-(2,5-dibromophenyl)-4,6-dimethyl-1H-benzimidazole |
|---|---|
| PubChem CID | 114373909 |
| Molecular Formula | C15H12Br2N2 |
| Molecular Weight | 380.08 g/mol |
| Exact Mass | 377.94 |
| IUPAC Name | 2-(2,5-dibromophenyl)-4,6-dimethyl-1H-benzimidazole |
| SMILES | Cc1cc(C)c2nc(-c3cc(Br)ccc3Br)[nH]c2c1 |
| InChI | InChI=1S/C15H12Br2N2/c1-8-5-9(2)14-13(6-8)18-15(19-14)11-7-10(16)3-4-12(11)17/h3-7H,1-2H3,(H,18,19) |
| InChIKey | UDPJUKHRGILNAC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.08 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |