About 3-bromo-5-(4,6-dimethyl-1H-benzimidazol-2-yl)aniline
3-bromo-5-(4,6-dimethyl-1H-benzimidazol-2-yl)aniline (PubChem CID 82947637) has the molecular formula C15H14BrN3
and a molecular weight of 316.20 g/mol. Its IUPAC name is 3-bromo-5-(4,6-dimethyl-1H-benzimidazol-2-yl)aniline.
Molecular Properties
| Compound Name | 3-bromo-5-(4,6-dimethyl-1H-benzimidazol-2-yl)aniline |
| PubChem CID | 82947637 |
| Molecular Formula | C15H14BrN3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 3-bromo-5-(4,6-dimethyl-1H-benzimidazol-2-yl)aniline |
| SMILES | Cc1cc(C)c2nc(-c3cc(N)cc(Br)c3)[nH]c2c1 |
| InChI | InChI=1S/C15H14BrN3/c1-8-3-9(2)14-13(4-8)18-15(19-14)10-5-11(16)7-12(17)6-10/h3-7H,17H2,1-2H3,(H,18,19) |
| InChIKey | FCVWLMIGTJGYTG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-5-(4,6-dimethyl-1H-benzimidazol-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-(4,6-dimethyl-1H-benzimidazol-2-yl)aniline?
The IUPAC name of 3-bromo-5-(4,6-dimethyl-1H-benzimidazol-2-yl)aniline (CID 82947637) is 3-bromo-5-(4,6-dimethyl-1H-benzimidazol-2-yl)aniline.
What is the SMILES notation for 3-bromo-5-(4,6-dimethyl-1H-benzimidazol-2-yl)aniline?
The canonical SMILES for 3-bromo-5-(4,6-dimethyl-1H-benzimidazol-2-yl)aniline is Cc1cc(C)c2nc(-c3cc(N)cc(Br)c3)[nH]c2c1.
What is the InChIKey of 3-bromo-5-(4,6-dimethyl-1H-benzimidazol-2-yl)aniline?
The InChIKey is FCVWLMIGTJGYTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrN3/c1-8-3-9(2)14-13(4-8)18-15(19-14)10-5-11(16)7-12(17)6-10/h3-7H,17H2,1-2H3,(H,18,19).
What are the key properties of 3-bromo-5-(4,6-dimethyl-1H-benzimidazol-2-yl)aniline?
3-bromo-5-(4,6-dimethyl-1H-benzimidazol-2-yl)aniline has a molecular weight of 316.20 g/mol, XLogP of 4.19, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-(4,6-dimethyl-1H-benzimidazol-2-yl)aniline is sourced from PubChem (CID 82947637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).