C15H13FN2 — CID 56773179
2-(4-fluorophenyl)-4,6-dimethyl-1H-benzimidazole (PubChem CID 56773179) has the molecular formula C15H13FN2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4,6-dimethyl-1H-benzimidazole.
| Compound Name | 2-(4-fluorophenyl)-4,6-dimethyl-1H-benzimidazole |
|---|---|
| PubChem CID | 56773179 |
| Molecular Formula | C15H13FN2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-(4-fluorophenyl)-4,6-dimethyl-1H-benzimidazole |
| SMILES | Cc1cc(C)c2nc(-c3ccc(F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C15H13FN2/c1-9-7-10(2)14-13(8-9)17-15(18-14)11-3-5-12(16)6-4-11/h3-8H,1-2H3,(H,17,18) |
| InChIKey | ZNVDFMGUUFHYOR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |