C14H14N2S — CID 82947476
4,6-dimethyl-2-(5-methylthiophen-2-yl)-1H-benzimidazole (PubChem CID 82947476) has the molecular formula C14H14N2S and a molecular weight of 242.35 g/mol. Its IUPAC name is 4,6-dimethyl-2-(5-methylthiophen-2-yl)-1H-benzimidazole.
| Compound Name | 4,6-dimethyl-2-(5-methylthiophen-2-yl)-1H-benzimidazole |
|---|---|
| PubChem CID | 82947476 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 4,6-dimethyl-2-(5-methylthiophen-2-yl)-1H-benzimidazole |
| SMILES | Cc1cc(C)c2nc(-c3ccc(C)s3)[nH]c2c1 |
| InChI | InChI=1S/C14H14N2S/c1-8-6-9(2)13-11(7-8)15-14(16-13)12-5-4-10(3)17-12/h4-7H,1-3H3,(H,15,16) |
| InChIKey | HKXZKMVJYBSCFU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |