C16H15ClN2 — CID 82946949
2-[4-(chloromethyl)phenyl]-4,6-dimethyl-1H-benzimidazole (PubChem CID 82946949) has the molecular formula C16H15ClN2 and a molecular weight of 270.76 g/mol. Its IUPAC name is 2-[4-(chloromethyl)phenyl]-4,6-dimethyl-1H-benzimidazole.
| Compound Name | 2-[4-(chloromethyl)phenyl]-4,6-dimethyl-1H-benzimidazole |
|---|---|
| PubChem CID | 82946949 |
| Molecular Formula | C16H15ClN2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-[4-(chloromethyl)phenyl]-4,6-dimethyl-1H-benzimidazole |
| SMILES | Cc1cc(C)c2nc(-c3ccc(CCl)cc3)[nH]c2c1 |
| InChI | InChI=1S/C16H15ClN2/c1-10-7-11(2)15-14(8-10)18-16(19-15)13-5-3-12(9-17)4-6-13/h3-8H,9H2,1-2H3,(H,18,19) |
| InChIKey | JXRYSEOOQPKHBA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|