C14H14N4 — CID 82947728
5-(4,6-dimethyl-1H-benzimidazol-2-yl)pyridin-3-amine (PubChem CID 82947728) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is 5-(4,6-dimethyl-1H-benzimidazol-2-yl)pyridin-3-amine.
| Compound Name | 5-(4,6-dimethyl-1H-benzimidazol-2-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 82947728 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 5-(4,6-dimethyl-1H-benzimidazol-2-yl)pyridin-3-amine |
| SMILES | Cc1cc(C)c2nc(-c3cncc(N)c3)[nH]c2c1 |
| InChI | InChI=1S/C14H14N4/c1-8-3-9(2)13-12(4-8)17-14(18-13)10-5-11(15)7-16-6-10/h3-7H,15H2,1-2H3,(H,17,18) |
| InChIKey | CBWCHVKJWMVDNJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |