C12H13F2NS — CID 114378284
(5,6-difluoro-3-propyl-1-benzothiophen-2-yl)methanamine (PubChem CID 114378284) has the molecular formula C12H13F2NS and a molecular weight of 241.31 g/mol. Its IUPAC name is (5,6-difluoro-3-propyl-1-benzothiophen-2-yl)methanamine.
| Compound Name | (5,6-difluoro-3-propyl-1-benzothiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 114378284 |
| Molecular Formula | C12H13F2NS |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | (5,6-difluoro-3-propyl-1-benzothiophen-2-yl)methanamine |
| SMILES | CCCc1c(CN)sc2cc(F)c(F)cc12 |
| InChI | InChI=1S/C12H13F2NS/c1-2-3-7-8-4-9(13)10(14)5-11(8)16-12(7)6-15/h4-5H,2-3,6,15H2,1H3 |
| InChIKey | NQDHPHCNSIGXEA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |