C12H17BrN2O2S2 — CID 114378838
3-amino-5-bromo-N,2-dimethyl-N-(thiolan-3-yl)benzenesulfonamide (PubChem CID 114378838) has the molecular formula C12H17BrN2O2S2 and a molecular weight of 365.32 g/mol. Its IUPAC name is 3-amino-5-bromo-N,2-dimethyl-N-(thiolan-3-yl)benzenesulfonamide.
| Compound Name | 3-amino-5-bromo-N,2-dimethyl-N-(thiolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114378838 |
| Molecular Formula | C12H17BrN2O2S2 |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 3-amino-5-bromo-N,2-dimethyl-N-(thiolan-3-yl)benzenesulfonamide |
| SMILES | Cc1c(N)cc(Br)cc1S(=O)(=O)N(C)C1CCSC1 |
| InChI | InChI=1S/C12H17BrN2O2S2/c1-8-11(14)5-9(13)6-12(8)19(16,17)15(2)10-3-4-18-7-10/h5-6,10H,3-4,7,14H2,1-2H3 |
| InChIKey | NHYVRVAPNZTLST-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|