C10H14ClN3O2S2 — CID 64608912
6-amino-5-chloro-N-methyl-N-(thiolan-3-yl)pyridine-3-sulfonamide (PubChem CID 64608912) has the molecular formula C10H14ClN3O2S2 and a molecular weight of 307.83 g/mol. Its IUPAC name is 6-amino-5-chloro-N-methyl-N-(thiolan-3-yl)pyridine-3-sulfonamide.
| Compound Name | 6-amino-5-chloro-N-methyl-N-(thiolan-3-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64608912 |
| Molecular Formula | C10H14ClN3O2S2 |
| Molecular Weight | 307.83 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 6-amino-5-chloro-N-methyl-N-(thiolan-3-yl)pyridine-3-sulfonamide |
| SMILES | CN(C1CCSC1)S(=O)(=O)c1cnc(N)c(Cl)c1 |
| InChI | InChI=1S/C10H14ClN3O2S2/c1-14(7-2-3-17-6-7)18(15,16)8-4-9(11)10(12)13-5-8/h4-5,7H,2-3,6H2,1H3,(H2,12,13) |
| InChIKey | LICMYZBRPILBLT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.83 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |