C14H18O7 — CID 11437973
[(3S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dioxo-3-prop-2-enyloxolan-3-yl] acetate (PubChem CID 11437973) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is [(3S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dioxo-3-prop-2-enyloxolan-3-yl] acetate.
| Compound Name | [(3S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dioxo-3-prop-2-enyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 11437973 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [(3S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dioxo-3-prop-2-enyloxolan-3-yl] acetate |
| SMILES | C=CC[C@@]1(OC(C)=O)C(=O)O[C@H]([C@@H]2COC(C)(C)O2)C1=O |
| InChI | InChI=1S/C14H18O7/c1-5-6-14(20-8(2)15)11(16)10(19-12(14)17)9-7-18-13(3,4)21-9/h5,9-10H,1,6-7H2,2-4H3/t9-,10+,14-/m0/s1 |
| InChIKey | LFYIQKSGCBIQOU-RBZYPMLTSA-N |
| XLogP | 0.51 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|