C14H22N4O3 — CID 114388895
ethyl 2-[(5,6-dimethyl-1,2,4-triazin-3-yl)carbamoyl]-3,3-dimethylbutanoate (PubChem CID 114388895) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is ethyl 2-[(5,6-dimethyl-1,2,4-triazin-3-yl)carbamoyl]-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-[(5,6-dimethyl-1,2,4-triazin-3-yl)carbamoyl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 114388895 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | ethyl 2-[(5,6-dimethyl-1,2,4-triazin-3-yl)carbamoyl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)Nc1nnc(C)c(C)n1)C(C)(C)C |
| InChI | InChI=1S/C14H22N4O3/c1-7-21-12(20)10(14(4,5)6)11(19)16-13-15-8(2)9(3)17-18-13/h10H,7H2,1-6H3,(H,15,16,18,19) |
| InChIKey | FUJURJQQTKMUNS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|