C15H23ClN4OS — CID 11439308
3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-piperidin-1-ylurea (PubChem CID 11439308) has the molecular formula C15H23ClN4OS and a molecular weight of 342.90 g/mol. Its IUPAC name is 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-piperidin-1-ylurea.
| Compound Name | 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-piperidin-1-ylurea |
|---|---|
| PubChem CID | 11439308 |
| Molecular Formula | C15H23ClN4OS |
| Molecular Weight | 342.90 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-piperidin-1-ylurea |
| SMILES | O=C(Nc1ncc(Cl)s1)N(C1CCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C15H23ClN4OS/c16-13-11-17-14(22-13)18-15(21)20(12-7-3-1-4-8-12)19-9-5-2-6-10-19/h11-12H,1-10H2,(H,17,18,21) |
| InChIKey | GBPTZJSEKSYYBZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.90 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |