C8H10FN3O3 — CID 114393853
2-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2-fluoroacetic acid (PubChem CID 114393853) has the molecular formula C8H10FN3O3 and a molecular weight of 215.18 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2-fluoroacetic acid.
| Compound Name | 2-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2-fluoroacetic acid |
|---|---|
| PubChem CID | 114393853 |
| Molecular Formula | C8H10FN3O3 |
| Molecular Weight | 215.18 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 2-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2-fluoroacetic acid |
| SMILES | CN(C)c1cnn(C(F)C(=O)O)c(=O)c1 |
| InChI | InChI=1S/C8H10FN3O3/c1-11(2)5-3-6(13)12(10-4-5)7(9)8(14)15/h3-4,7H,1-2H3,(H,14,15) |
| InChIKey | RERKMEWGWHOVNZ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.18 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |