C11H15FN4O3 — CID 114393936
2-fluoro-2-[4-(4-methylpiperazin-1-yl)-6-oxopyridazin-1-yl]acetic acid (PubChem CID 114393936) has the molecular formula C11H15FN4O3 and a molecular weight of 270.26 g/mol. Its IUPAC name is 2-fluoro-2-[4-(4-methylpiperazin-1-yl)-6-oxopyridazin-1-yl]acetic acid.
| Compound Name | 2-fluoro-2-[4-(4-methylpiperazin-1-yl)-6-oxopyridazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 114393936 |
| Molecular Formula | C11H15FN4O3 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-fluoro-2-[4-(4-methylpiperazin-1-yl)-6-oxopyridazin-1-yl]acetic acid |
| SMILES | CN1CCN(c2cnn(C(F)C(=O)O)c(=O)c2)CC1 |
| InChI | InChI=1S/C11H15FN4O3/c1-14-2-4-15(5-3-14)8-6-9(17)16(13-7-8)10(12)11(18)19/h6-7,10H,2-5H2,1H3,(H,18,19) |
| InChIKey | YVUQQPLTAOUMRQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |