C9H12FN3O3 — CID 114393993
2-[4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]-2-fluoroacetic acid (PubChem CID 114393993) has the molecular formula C9H12FN3O3 and a molecular weight of 229.21 g/mol. Its IUPAC name is 2-[4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]-2-fluoroacetic acid.
| Compound Name | 2-[4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]-2-fluoroacetic acid |
|---|---|
| PubChem CID | 114393993 |
| Molecular Formula | C9H12FN3O3 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-[4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]-2-fluoroacetic acid |
| SMILES | CCN(C)c1cnn(C(F)C(=O)O)c(=O)c1 |
| InChI | InChI=1S/C9H12FN3O3/c1-3-12(2)6-4-7(14)13(11-5-6)8(10)9(15)16/h4-5,8H,3H2,1-2H3,(H,15,16) |
| InChIKey | QIOLUCFIHRHTRO-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |