C11H14FN3O3 — CID 114393914
2-fluoro-2-(6-oxo-4-piperidin-1-ylpyridazin-1-yl)acetic acid (PubChem CID 114393914) has the molecular formula C11H14FN3O3 and a molecular weight of 255.25 g/mol. Its IUPAC name is 2-fluoro-2-(6-oxo-4-piperidin-1-ylpyridazin-1-yl)acetic acid.
| Compound Name | 2-fluoro-2-(6-oxo-4-piperidin-1-ylpyridazin-1-yl)acetic acid |
|---|---|
| PubChem CID | 114393914 |
| Molecular Formula | C11H14FN3O3 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-fluoro-2-(6-oxo-4-piperidin-1-ylpyridazin-1-yl)acetic acid |
| SMILES | O=C(O)C(F)n1ncc(N2CCCCC2)cc1=O |
| InChI | InChI=1S/C11H14FN3O3/c12-10(11(17)18)15-9(16)6-8(7-13-15)14-4-2-1-3-5-14/h6-7,10H,1-5H2,(H,17,18) |
| InChIKey | UTQPOACMFVOGIX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |