C10H14FN3O3 — CID 114394037
2-[4-(diethylamino)-6-oxopyridazin-1-yl]-2-fluoroacetic acid (PubChem CID 114394037) has the molecular formula C10H14FN3O3 and a molecular weight of 243.24 g/mol. Its IUPAC name is 2-[4-(diethylamino)-6-oxopyridazin-1-yl]-2-fluoroacetic acid.
| Compound Name | 2-[4-(diethylamino)-6-oxopyridazin-1-yl]-2-fluoroacetic acid |
|---|---|
| PubChem CID | 114394037 |
| Molecular Formula | C10H14FN3O3 |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-[4-(diethylamino)-6-oxopyridazin-1-yl]-2-fluoroacetic acid |
| SMILES | CCN(CC)c1cnn(C(F)C(=O)O)c(=O)c1 |
| InChI | InChI=1S/C10H14FN3O3/c1-3-13(4-2)7-5-8(15)14(12-6-7)9(11)10(16)17/h5-6,9H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | FQCFOLHLPUXRNE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |